![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | ART12DRAMALT04/ | 2015-06-22 16:12 | - | |
![[DIR]](/icons/folder.gif) | ART12Grades/ | 2015-06-22 16:12 | - | |
![[DIR]](/icons/folder.gif) | ART_IMAGES/ | 2015-06-22 11:26 | - | |
![[DIR]](/icons/folder.gif) | Academy figures expressive/ | 2015-06-22 11:25 | - | |
![[DIR]](/icons/folder.gif) | Adv_Art11_photo_narrative 2013/ | 2019-10-02 13:17 | - | |
![[DIR]](/icons/folder.gif) | Adv_Art11_photo_narrative2013/ | 2019-10-02 13:18 | - | |
![[DIR]](/icons/folder.gif) | Art12outline.pages/ | 2015-06-22 11:26 | - | |
![[DIR]](/icons/folder.gif) | ArtFutureCareer/ | 2015-06-22 16:12 | - | |
![[DIR]](/icons/folder.gif) | ArtStatementexemplar/ | 2015-06-22 11:26 | - | |
![[DIR]](/icons/folder.gif) | Art_Test_2005/ | 2015-06-22 11:26 | - | |
![[DIR]](/icons/folder.gif) | Art_test_demo/ | 2015-06-22 11:26 | - | |
![[DIR]](/icons/folder.gif) | Freud/ | 2015-06-22 16:12 | - | |
![[DIR]](/icons/folder.gif) | JillTies/ | 2015-06-22 16:13 | - | |
![[DIR]](/icons/folder.gif) | Judy Chicago/ | 2015-06-22 11:26 | - | |
![[DIR]](/icons/folder.gif) | personalevent2004/ | 2015-06-22 16:13 | - | |
![[TXT]](/icons/text.gif) | Art12resources.html | 2015-06-22 16:12 | 389 | |
![[TXT]](/icons/text.gif) | art12HISTORYPROJ.html | 2015-06-22 16:12 | 1.2K | |
![[TXT]](/icons/text.gif) | NSCADProjects.html | 2015-06-22 16:13 | 2.3K | |
![[ ]](/icons/unknown.gif) | art12_artStat_ChristHead.rtf | 2015-06-22 16:12 | 2.7K | |
![[TXT]](/icons/text.gif) | NSCADtrip.html | 2015-06-22 16:13 | 3.6K | |
![[TXT]](/icons/text.gif) | Art12 _Assessment_Criteria | 2015-06-22 16:12 | 4.1K | |
![[TXT]](/icons/text.gif) | ART12_Term_II | 2015-06-22 16:12 | 5.2K | |
![[TXT]](/icons/text.gif) | art12PresentSchedule.htm | 2015-06-22 16:12 | 7.6K | |
![[TXT]](/icons/text.gif) | Art12 _Assessment.html | 2015-06-22 16:12 | 8.2K | |
![[TXT]](/icons/text.gif) | art12Term1Essay.html | 2015-06-22 16:12 | 9.7K | |
![[TXT]](/icons/text.gif) | Art12_T2_Hist.html | 2015-06-22 16:12 | 14K | |
![[ ]](/icons/layout.gif) | 4drawingsRubric.pdf | 2015-06-22 16:12 | 17K | |
![[ ]](/icons/layout.gif) | HUMAN FORMproj.pdf | 2015-06-22 16:13 | 18K | |
![[ ]](/icons/unknown.gif) | ConcentrationProbes.doc | 2015-06-22 16:12 | 19K | |
![[TXT]](/icons/text.gif) | Art11_12_B_projects.html | 2019-10-03 11:29 | 20K | |
![[ ]](/icons/unknown.gif) | Essay plan structure | 2015-06-22 16:12 | 21K | |
![[ ]](/icons/unknown.gif) | Essay plan structure.doc | 2015-06-22 16:12 | 21K | |
![[TXT]](/icons/text.gif) | art12studioproject.html | 2016-09-23 15:13 | 22K | |
![[ ]](/icons/unknown.gif) | Art12orderForm.doc | 2015-06-22 16:12 | 22K | |
![[ ]](/icons/unknown.gif) | OrganicObject.docx | 2019-02-12 11:33 | 23K | |
![[ ]](/icons/unknown.gif) | OnWritingWell.doc | 2015-06-22 16:13 | 25K | |
![[ ]](/icons/unknown.gif) | Essay_Plan.doc | 2015-06-22 16:12 | 26K | |
![[ ]](/icons/unknown.gif) | test1review.doc | 2015-06-22 16:13 | 26K | |
![[ ]](/icons/unknown.gif) | Art12Projectsubmission.doc | 2015-06-22 16:12 | 27K | |
![[ ]](/icons/layout.gif) | Artist Research Assessment.pdf | 2015-06-22 16:12 | 29K | |
![[ ]](/icons/unknown.gif) | Art12ArtAssessOLD.doc | 2015-06-22 16:12 | 29K | |
![[ ]](/icons/unknown.gif) | The_Curator_in_You.doc | 2015-06-22 16:13 | 32K | |
![[ ]](/icons/unknown.gif) | HUMAN FORM.doc | 2015-06-22 16:13 | 32K | |
![[ ]](/icons/unknown.gif) | Concentrationprobes2.doc | 2015-06-22 16:12 | 33K | |
![[ ]](/icons/unknown.gif) | studiocritiques.xlsx | 2015-06-22 16:13 | 34K | |
![[ ]](/icons/unknown.gif) | Art12EssayEvaluationold.doc | 2015-06-22 16:12 | 38K | |
![[ ]](/icons/layout.gif) | observational_drawing_targets_Art12.pdf | 2015-06-22 16:13 | 38K | |
![[ ]](/icons/layout.gif) | Art 12MYWassess.pdf | 2015-06-22 16:12 | 38K | |
![[ ]](/icons/unknown.gif) | Ritual_Presentations.doc | 2015-06-22 16:13 | 40K | |
![[ ]](/icons/layout.gif) | art12supplies.pdf | 2015-06-22 16:12 | 44K | |
![[ ]](/icons/unknown.gif) | Art12ArtHistEval.doc | 2015-06-22 16:12 | 44K | |
![[ ]](/icons/unknown.gif) | Word Work File D_627910630 | 2015-06-22 16:13 | 45K | |
![[ ]](/icons/unknown.gif) | Word Work File D_1.tmp | 2015-06-22 16:13 | 47K | |
![[ ]](/icons/unknown.gif) | Art12outline.doc | 2015-06-22 16:12 | 49K | |
![[ ]](/icons/layout.gif) | ArtHistory_essay _test2014.pdf | 2015-06-22 16:12 | 49K | |
![[ ]](/icons/unknown.gif) | Art12Sketchbookideasold.doc | 2015-06-22 16:12 | 50K | |
![[ ]](/icons/unknown.gif) | OrganicObject.doc | 2015-06-22 16:13 | 51K | |
![[ ]](/icons/unknown.gif) | Art12EssayEvaluation.doc | 2015-06-22 16:12 | 53K | |
![[ ]](/icons/unknown.gif) | Word Work File D_990618531.tmp | 2015-06-22 16:13 | 53K | |
![[ ]](/icons/layout.gif) | Essay_Plan.pdf | 2015-06-22 16:12 | 55K | |
![[ ]](/icons/unknown.gif) | Artist Research Assessment.docx | 2015-06-22 16:12 | 56K | |
![[ ]](/icons/layout.gif) | HumanForm.pdf | 2015-06-22 16:13 | 57K | |
![[ ]](/icons/layout.gif) | HumanFormAHis.pdf | 2015-06-22 16:13 | 57K | |
![[ ]](/icons/unknown.gif) | Art12Presentations peer review.docx | 2015-06-22 16:12 | 59K | |
![[ ]](/icons/layout.gif) | Art12Projectsubmission.pdf | 2015-06-22 16:12 | 62K | |
![[ ]](/icons/layout.gif) | Sketch_Eval_Art12.pdf | 2017-01-13 13:27 | 63K | |
![[ ]](/icons/unknown.gif) | Art12ArtAssess.doc | 2015-06-22 16:12 | 70K | |
![[ ]](/icons/layout.gif) | Art12ArtHistEval.pdf | 2015-06-22 16:12 | 70K | |
![[IMG]](/icons/image2.gif) | tebogtprint.jpg | 2015-06-22 16:13 | 74K | |
![[ ]](/icons/layout.gif) | Art12Sketchbookideas.pdf | 2015-06-22 16:12 | 76K | |
![[ ]](/icons/layout.gif) | Art12EssayEvaluation.pdf | 2015-06-22 16:12 | 78K | |
![[IMG]](/icons/image2.gif) | art12photoshorton.jpg | 2015-06-22 16:12 | 79K | |
![[ ]](/icons/unknown.gif) | Art12Sketchbookideas.doc | 2015-06-22 16:12 | 93K | |
![[ ]](/icons/unknown.gif) | art12SketchActivities.doc | 2015-06-22 16:12 | 93K | |
![[ ]](/icons/layout.gif) | OrganicObject.pdf | 2019-02-12 11:34 | 96K | |
![[ ]](/icons/layout.gif) | Art12ArtAssess.pdf | 2015-06-22 16:12 | 96K | |
![[IMG]](/icons/image2.gif) | AnneMacmillan.jpg | 2015-06-22 16:12 | 98K | |
![[ ]](/icons/unknown.gif) | art assessment.docx | 2015-06-22 16:12 | 99K | |
![[ ]](/icons/layout.gif) | 10studytips.pdf | 2015-06-22 16:12 | 106K | |
![[ ]](/icons/unknown.gif) | atc.doc | 2015-06-22 16:12 | 110K | |
![[ ]](/icons/unknown.gif) | ArtHistory_essay _test2014.pages | 2015-06-22 16:12 | 110K | |
![[ ]](/icons/unknown.gif) | observational_drawing_targets_Art12.pages | 2015-06-22 16:13 | 111K | |
![[ ]](/icons/unknown.gif) | Art12 test scoresheet.pages | 2015-06-22 16:12 | 129K | |
![[IMG]](/icons/image2.gif) | warhol_basquait_boxers.jpg | 2015-06-22 16:13 | 132K | |
![[ ]](/icons/layout.gif) | Arthistorycheatcards.pdf | 2015-06-22 16:12 | 135K | |
![[ ]](/icons/layout.gif) | Art12outline.pdf | 2015-06-22 16:12 | 166K | |
![[IMG]](/icons/image2.gif) | Nadar_autoportrait_tournant.gif | 2015-06-22 16:13 | 249K | |
![[IMG]](/icons/image2.gif) | francis-bacon-pope-innocente-x-velazquez-comparison.jpg | 2015-06-22 16:12 | 257K | |
![[ ]](/icons/unknown.gif) | Art12outline2012.pages | 2015-06-22 16:12 | 278K | |
![[ ]](/icons/unknown.gif) | Arthistorycheatcards.pages | 2015-06-22 16:12 | 302K | |
![[ ]](/icons/layout.gif) | JudyChicago.pdf | 2015-06-22 16:13 | 342K | |
![[ ]](/icons/layout.gif) | Art12_test_review.pdf | 2015-06-22 16:12 | 392K | |
![[ ]](/icons/unknown.gif) | Art12_test_review.pdf0 | 2015-06-22 16:12 | 392K | |
![[IMG]](/icons/image2.gif) | anneMcmillan.gif | 2015-06-22 16:12 | 412K | |
![[ ]](/icons/unknown.gif) | Art 12 T2 studio and art history projects.pages | 2015-06-22 16:12 | 464K | |
![[ ]](/icons/layout.gif) | Social_Justice_Environmental_Issue_Mixed_Media_gr12.pdf | 2015-06-22 16:13 | 481K | |
![[ ]](/icons/layout.gif) | Art 12 T2 studio and art history projects.pages.pdf | 2015-06-22 16:12 | 587K | |
![[ ]](/icons/layout.gif) | Art 12 T2 studio and art history projects.pdf | 2015-06-22 16:12 | 587K | |
![[IMG]](/icons/image2.gif) | Untitled-1.png | 2015-06-22 16:13 | 607K | |
![[ ]](/icons/layout.gif) | Art12_Self_Portrait_Proj.pdf | 2016-09-23 15:05 | 1.4M | |
![[IMG]](/icons/image2.gif) | art12photoshhs.png | 2015-06-22 16:12 | 1.5M | |
![[ ]](/icons/unknown.gif) | Art12_Self_Portrait_Proj.doc | 2016-09-23 15:05 | 1.5M | |
![[VID]](/icons/movie.gif) | Robin_Young_foodscape.mp4 | 2015-06-22 16:13 | 2.5M | |
![[ ]](/icons/unknown.gif) | ArtEssay_ Essay1exemplar.doc | 2015-06-22 16:12 | 5.1M | |
|